C24H20O3 — CID 86256397
5-(1,3-diphenylprop-2-ynyl)-2,4-dimethoxybenzaldehyde (PubChem CID 86256397) has the molecular formula C24H20O3 and a molecular weight of 356.42 g/mol. Its IUPAC name is 5-(1,3-diphenylprop-2-ynyl)-2,4-dimethoxybenzaldehyde.
| Compound Name | 5-(1,3-diphenylprop-2-ynyl)-2,4-dimethoxybenzaldehyde |
|---|---|
| PubChem CID | 86256397 |
| Molecular Formula | C24H20O3 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 5-(1,3-diphenylprop-2-ynyl)-2,4-dimethoxybenzaldehyde |
| SMILES | COc1cc(OC)c(C(C#Cc2ccccc2)c2ccccc2)cc1C=O |
| InChI | InChI=1S/C24H20O3/c1-26-23-16-24(27-2)22(15-20(23)17-25)21(19-11-7-4-8-12-19)14-13-18-9-5-3-6-10-18/h3-12,15-17,21H,1-2H3 |
| InChIKey | NLHCUFRAFXWILB-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|