C17H20N2O7S — CID 8625982
[2-oxo-2-(prop-2-ynylamino)ethyl] 3-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylamino)propanoate (PubChem CID 8625982) has the molecular formula C17H20N2O7S and a molecular weight of 396.42 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-ynylamino)ethyl] 3-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylamino)propanoate.
| Compound Name | [2-oxo-2-(prop-2-ynylamino)ethyl] 3-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylamino)propanoate |
|---|---|
| PubChem CID | 8625982 |
| Molecular Formula | C17H20N2O7S |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | [2-oxo-2-(prop-2-ynylamino)ethyl] 3-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylamino)propanoate |
| SMILES | C#CCNC(=O)COC(=O)CCNS(=O)(=O)c1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C17H20N2O7S/c1-2-7-18-16(20)12-26-17(21)6-8-19-27(22,23)13-4-5-14-15(11-13)25-10-3-9-24-14/h1,4-5,11,19H,3,6-10,12H2,(H,18,20) |
| InChIKey | RIVPOHGINWPLFW-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|