C14H15BrN2O5S — CID 9071100
[2-oxo-2-(prop-2-ynylamino)ethyl] 3-[(4-bromophenyl)sulfonylamino]propanoate (PubChem CID 9071100) has the molecular formula C14H15BrN2O5S and a molecular weight of 403.25 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-ynylamino)ethyl] 3-[(4-bromophenyl)sulfonylamino]propanoate.
| Compound Name | [2-oxo-2-(prop-2-ynylamino)ethyl] 3-[(4-bromophenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 9071100 |
| Molecular Formula | C14H15BrN2O5S |
| Molecular Weight | 403.25 g/mol |
| Exact Mass | 401.99 |
| IUPAC Name | [2-oxo-2-(prop-2-ynylamino)ethyl] 3-[(4-bromophenyl)sulfonylamino]propanoate |
| SMILES | C#CCNC(=O)COC(=O)CCNS(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H15BrN2O5S/c1-2-8-16-13(18)10-22-14(19)7-9-17-23(20,21)12-5-3-11(15)4-6-12/h1,3-6,17H,7-10H2,(H,16,18) |
| InChIKey | BSEQAZAVUMWUJT-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.25 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|