C6H5N — CID 86260209
2-azabicyclo[3.2.0]hepta-1,3,6-triene (PubChem CID 86260209) has the molecular formula C6H5N and a molecular weight of 91.11 g/mol. Its IUPAC name is 2-azabicyclo[3.2.0]hepta-1,3,6-triene.
| Compound Name | 2-azabicyclo[3.2.0]hepta-1,3,6-triene |
|---|---|
| PubChem CID | 86260209 |
| Molecular Formula | C6H5N |
| Molecular Weight | 91.11 g/mol |
| Exact Mass | 91.04 |
| IUPAC Name | 2-azabicyclo[3.2.0]hepta-1,3,6-triene |
| SMILES | C1=CC2C=CC2=N1 |
| InChI | InChI=1S/C6H5N/c1-2-6-5(1)3-4-7-6/h1-5H |
| InChIKey | LLYPFVIXXHSBEK-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 91.11 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |