About 7aH-thieno[3,2-b]pyridin-7-one
7aH-thieno[3,2-b]pyridin-7-one (PubChem CID 71304750) has the molecular formula C7H5NOS
and a molecular weight of 151.19 g/mol. Its IUPAC name is 7aH-thieno[3,2-b]pyridin-7-one.
Molecular Properties
| Compound Name | 7aH-thieno[3,2-b]pyridin-7-one |
| PubChem CID | 71304750 |
| Molecular Formula | C7H5NOS |
| Molecular Weight | 151.19 g/mol |
| Exact Mass | 151.01 |
| IUPAC Name | 7aH-thieno[3,2-b]pyridin-7-one |
| SMILES | O=C1C=CN=C2C=CSC12 |
| InChI | InChI=1S/C7H5NOS/c9-6-1-3-8-5-2-4-10-7(5)6/h1-4,7H |
| InChIKey | LLXLYMIJSXJZLK-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.19 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7aH-thieno[3,2-b]pyridin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7aH-thieno[3,2-b]pyridin-7-one?
The IUPAC name of 7aH-thieno[3,2-b]pyridin-7-one (CID 71304750) is 7aH-thieno[3,2-b]pyridin-7-one.
What is the SMILES notation for 7aH-thieno[3,2-b]pyridin-7-one?
The canonical SMILES for 7aH-thieno[3,2-b]pyridin-7-one is O=C1C=CN=C2C=CSC12.
What is the InChIKey of 7aH-thieno[3,2-b]pyridin-7-one?
The InChIKey is LLXLYMIJSXJZLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NOS/c9-6-1-3-8-5-2-4-10-7(5)6/h1-4,7H.
What are the key properties of 7aH-thieno[3,2-b]pyridin-7-one?
7aH-thieno[3,2-b]pyridin-7-one has a molecular weight of 151.19 g/mol, XLogP of 1.15, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7aH-thieno[3,2-b]pyridin-7-one is sourced from PubChem (CID 71304750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).