C10H8 — CID 13484330
tricyclo[5.2.1.04,10]deca-1(10),2,5,8-tetraene (PubChem CID 13484330) has the molecular formula C10H8 and a molecular weight of 128.17 g/mol. Its IUPAC name is tricyclo[5.2.1.04,10]deca-1(10),2,5,8-tetraene.
| Compound Name | tricyclo[5.2.1.04,10]deca-1(10),2,5,8-tetraene |
|---|---|
| PubChem CID | 13484330 |
| Molecular Formula | C10H8 |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.06 |
| IUPAC Name | tricyclo[5.2.1.04,10]deca-1(10),2,5,8-tetraene |
| SMILES | C1=CC2C=CC3C=CC1=C23 |
| InChI | InChI=1S/C10H8/c1-2-8-5-6-9-4-3-7(1)10(8)9/h1-8H |
| InChIKey | SHCGEABSMZCXEN-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|