About 3aH-pentalene-1-thione
3aH-pentalene-1-thione (PubChem CID 91035875) has the molecular formula C8H6S
and a molecular weight of 134.20 g/mol. Its IUPAC name is 3aH-pentalene-1-thione.
Molecular Properties
| Compound Name | 3aH-pentalene-1-thione |
| PubChem CID | 91035875 |
| Molecular Formula | C8H6S |
| Molecular Weight | 134.20 g/mol |
| Exact Mass | 134.02 |
| IUPAC Name | 3aH-pentalene-1-thione |
| SMILES | S=C1C=CC2C=CC=C12 |
| InChI | InChI=1S/C8H6S/c9-8-5-4-6-2-1-3-7(6)8/h1-6H |
| InChIKey | NLNNJTFUHGSFQY-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.20 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3aH-pentalene-1-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3aH-pentalene-1-thione?
The IUPAC name of 3aH-pentalene-1-thione (CID 91035875) is 3aH-pentalene-1-thione.
What is the SMILES notation for 3aH-pentalene-1-thione?
The canonical SMILES for 3aH-pentalene-1-thione is S=C1C=CC2C=CC=C12.
What is the InChIKey of 3aH-pentalene-1-thione?
The InChIKey is NLNNJTFUHGSFQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6S/c9-8-5-4-6-2-1-3-7(6)8/h1-6H.
What are the key properties of 3aH-pentalene-1-thione?
3aH-pentalene-1-thione has a molecular weight of 134.20 g/mol, XLogP of 2.04, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3aH-pentalene-1-thione is sourced from PubChem (CID 91035875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).