C9H9NS — CID 98553988
(1S,6R)-7-azabicyclo[4.2.2]deca-2,4,9-triene-8-thione (PubChem CID 98553988) has the molecular formula C9H9NS and a molecular weight of 163.25 g/mol. Its IUPAC name is (1S,6R)-7-azabicyclo[4.2.2]deca-2,4,9-triene-8-thione.
| Compound Name | (1S,6R)-7-azabicyclo[4.2.2]deca-2,4,9-triene-8-thione |
|---|---|
| PubChem CID | 98553988 |
| Molecular Formula | C9H9NS |
| Molecular Weight | 163.25 g/mol |
| Exact Mass | 163.05 |
| IUPAC Name | (1S,6R)-7-azabicyclo[4.2.2]deca-2,4,9-triene-8-thione |
| SMILES | S=C1N[C@@H]2C=CC=C[C@H]1C=C2 |
| InChI | InChI=1S/C9H9NS/c11-9-7-3-1-2-4-8(10-9)6-5-7/h1-8H,(H,10,11)/t7-,8+/m0/s1 |
| InChIKey | AEVLHWQZZQFUMZ-JGVFFNPUSA-N |
| XLogP | 1.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.25 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|