C15H23NS3 — CID 86260389
2-[(2-hexyl-1,3-dithian-2-yl)sulfanyl]pyridine (PubChem CID 86260389) has the molecular formula C15H23NS3 and a molecular weight of 313.56 g/mol. Its IUPAC name is 2-[(2-hexyl-1,3-dithian-2-yl)sulfanyl]pyridine.
| Compound Name | 2-[(2-hexyl-1,3-dithian-2-yl)sulfanyl]pyridine |
|---|---|
| PubChem CID | 86260389 |
| Molecular Formula | C15H23NS3 |
| Molecular Weight | 313.56 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 2-[(2-hexyl-1,3-dithian-2-yl)sulfanyl]pyridine |
| SMILES | CCCCCCC1(Sc2ccccn2)SCCCS1 |
| InChI | InChI=1S/C15H23NS3/c1-2-3-4-6-10-15(17-12-8-13-18-15)19-14-9-5-7-11-16-14/h5,7,9,11H,2-4,6,8,10,12-13H2,1H3 |
| InChIKey | NRUHKTLPYBZYLO-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.56 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|