C8H13ClN2O2S — CID 86262251
3-(pyrrolidin-2-ylmethyl)-1,3-thiazolidine-2,4-dione;hydrochloride (PubChem CID 86262251) has the molecular formula C8H13ClN2O2S and a molecular weight of 236.72 g/mol. Its IUPAC name is 3-(pyrrolidin-2-ylmethyl)-1,3-thiazolidine-2,4-dione;hydrochloride.
| Compound Name | 3-(pyrrolidin-2-ylmethyl)-1,3-thiazolidine-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 86262251 |
| Molecular Formula | C8H13ClN2O2S |
| Molecular Weight | 236.72 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 3-(pyrrolidin-2-ylmethyl)-1,3-thiazolidine-2,4-dione;hydrochloride |
| SMILES | Cl.O=C1CSC(=O)N1CC1CCCN1 |
| InChI | InChI=1S/C8H12N2O2S.ClH/c11-7-5-13-8(12)10(7)4-6-2-1-3-9-6;/h6,9H,1-5H2;1H |
| InChIKey | CYZQUGSSDAKDDE-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.72 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|