C20H19BrN4O3 — CID 86265375
2-[1-(6-bromo-2-methylindazole-3-carbonyl)azetidin-3-yl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 86265375) has the molecular formula C20H19BrN4O3 and a molecular weight of 443.30 g/mol. Its IUPAC name is 2-[1-(6-bromo-2-methylindazole-3-carbonyl)azetidin-3-yl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-[1-(6-bromo-2-methylindazole-3-carbonyl)azetidin-3-yl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 86265375 |
| Molecular Formula | C20H19BrN4O3 |
| Molecular Weight | 443.30 g/mol |
| Exact Mass | 442.06 |
| IUPAC Name | 2-[1-(6-bromo-2-methylindazole-3-carbonyl)azetidin-3-yl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | Cn1nc2cc(Br)ccc2c1C(=O)N1CC(N2C(=O)C3CC=CCC3C2=O)C1 |
| InChI | InChI=1S/C20H19BrN4O3/c1-23-17(15-7-6-11(21)8-16(15)22-23)20(28)24-9-12(10-24)25-18(26)13-4-2-3-5-14(13)19(25)27/h2-3,6-8,12-14H,4-5,9-10H2,1H3 |
| InChIKey | CZPNPZUZCSIYMB-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.30 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|