C16H15BrN2O4 — CID 99989731
(3aS,7aS)-2-[1-(5-bromofuran-2-carbonyl)azetidin-3-yl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 99989731) has the molecular formula C16H15BrN2O4 and a molecular weight of 379.21 g/mol. Its IUPAC name is (3aS,7aS)-2-[1-(5-bromofuran-2-carbonyl)azetidin-3-yl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aS,7aS)-2-[1-(5-bromofuran-2-carbonyl)azetidin-3-yl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 99989731 |
| Molecular Formula | C16H15BrN2O4 |
| Molecular Weight | 379.21 g/mol |
| Exact Mass | 378.02 |
| IUPAC Name | (3aS,7aS)-2-[1-(5-bromofuran-2-carbonyl)azetidin-3-yl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | O=C(c1ccc(Br)o1)N1CC(N2C(=O)[C@H]3CC=CC[C@@H]3C2=O)C1 |
| InChI | InChI=1S/C16H15BrN2O4/c17-13-6-5-12(23-13)16(22)18-7-9(8-18)19-14(20)10-3-1-2-4-11(10)15(19)21/h1-2,5-6,9-11H,3-4,7-8H2/t10-,11-/m0/s1 |
| InChIKey | IRSHLSDSSARCDI-QWRGUYRKSA-N |
| XLogP | 1.82 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.21 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|