C18H16BrNO3 — CID 86267113
N-[2-(1-benzofuran-2-yl)-2-hydroxypropyl]-2-bromobenzamide (PubChem CID 86267113) has the molecular formula C18H16BrNO3 and a molecular weight of 374.23 g/mol. Its IUPAC name is N-[2-(1-benzofuran-2-yl)-2-hydroxypropyl]-2-bromobenzamide.
| Compound Name | N-[2-(1-benzofuran-2-yl)-2-hydroxypropyl]-2-bromobenzamide |
|---|---|
| PubChem CID | 86267113 |
| Molecular Formula | C18H16BrNO3 |
| Molecular Weight | 374.23 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | N-[2-(1-benzofuran-2-yl)-2-hydroxypropyl]-2-bromobenzamide |
| SMILES | CC(O)(CNC(=O)c1ccccc1Br)c1cc2ccccc2o1 |
| InChI | InChI=1S/C18H16BrNO3/c1-18(22,16-10-12-6-2-5-9-15(12)23-16)11-20-17(21)13-7-3-4-8-14(13)19/h2-10,22H,11H2,1H3,(H,20,21) |
| InChIKey | GCLYMBXKRWWSSA-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.23 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |