C20H27N3O6 — CID 8626885
N-[(4-ethoxy-3-methoxyphenyl)methyl]-N-ethyl-2-(2,4,5-trioxo-3-propylimidazolidin-1-yl)acetamide (PubChem CID 8626885) has the molecular formula C20H27N3O6 and a molecular weight of 405.45 g/mol. Its IUPAC name is N-[(4-ethoxy-3-methoxyphenyl)methyl]-N-ethyl-2-(2,4,5-trioxo-3-propylimidazolidin-1-yl)acetamide.
| Compound Name | N-[(4-ethoxy-3-methoxyphenyl)methyl]-N-ethyl-2-(2,4,5-trioxo-3-propylimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 8626885 |
| Molecular Formula | C20H27N3O6 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | N-[(4-ethoxy-3-methoxyphenyl)methyl]-N-ethyl-2-(2,4,5-trioxo-3-propylimidazolidin-1-yl)acetamide |
| SMILES | CCCN1C(=O)C(=O)N(CC(=O)N(CC)Cc2ccc(OCC)c(OC)c2)C1=O |
| InChI | InChI=1S/C20H27N3O6/c1-5-10-22-18(25)19(26)23(20(22)27)13-17(24)21(6-2)12-14-8-9-15(29-7-3)16(11-14)28-4/h8-9,11H,5-7,10,12-13H2,1-4H3 |
| InChIKey | LQYIGTHIFDRTLI-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 96.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|