C13H20N6O7S — CID 86269741
[(2S,5R)-2-[[2-amino-2-(3-methylimidazol-4-yl)ethoxy]carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 86269741) has the molecular formula C13H20N6O7S and a molecular weight of 404.41 g/mol. Its IUPAC name is [(2S,5R)-2-[[2-amino-2-(3-methylimidazol-4-yl)ethoxy]carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5R)-2-[[2-amino-2-(3-methylimidazol-4-yl)ethoxy]carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 86269741 |
| Molecular Formula | C13H20N6O7S |
| Molecular Weight | 404.41 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | [(2S,5R)-2-[[2-amino-2-(3-methylimidazol-4-yl)ethoxy]carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | Cn1cncc1C(N)CONC(=O)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C13H20N6O7S/c1-17-7-15-4-11(17)9(14)6-25-16-12(20)10-3-2-8-5-18(10)13(21)19(8)26-27(22,23)24/h4,7-10H,2-3,5-6,14H2,1H3,(H,16,20)(H,22,23,24)/t8-,9?,10+/m1/s1 |
| InChIKey | RYMJJKNGTCGYEY-FIBVVXLUSA-N |
| XLogP | -1.53 |
| TPSA | 169.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.41 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|