C21H26O7S — CID 86273531
6-hydroxyhexyl 4-hydroxy-2-methoxy-5-(4-methylbenzoyl)benzenesulfonate (PubChem CID 86273531) has the molecular formula C21H26O7S and a molecular weight of 422.50 g/mol. Its IUPAC name is 6-hydroxyhexyl 4-hydroxy-2-methoxy-5-(4-methylbenzoyl)benzenesulfonate.
| Compound Name | 6-hydroxyhexyl 4-hydroxy-2-methoxy-5-(4-methylbenzoyl)benzenesulfonate |
|---|---|
| PubChem CID | 86273531 |
| Molecular Formula | C21H26O7S |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | 6-hydroxyhexyl 4-hydroxy-2-methoxy-5-(4-methylbenzoyl)benzenesulfonate |
| SMILES | COc1cc(O)c(C(=O)c2ccc(C)cc2)cc1S(=O)(=O)OCCCCCCO |
| InChI | InChI=1S/C21H26O7S/c1-15-7-9-16(10-8-15)21(24)17-13-20(19(27-2)14-18(17)23)29(25,26)28-12-6-4-3-5-11-22/h7-10,13-14,22-23H,3-6,11-12H2,1-2H3 |
| InChIKey | JXZMSKHERQSEDH-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|