C26H28ClFN2O4 — CID 86275675
8-chloro-7-[4-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]butoxy]-2-methyl-2,3-dihydrochromen-4-one (PubChem CID 86275675) has the molecular formula C26H28ClFN2O4 and a molecular weight of 486.97 g/mol. Its IUPAC name is 8-chloro-7-[4-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]butoxy]-2-methyl-2,3-dihydrochromen-4-one.
| Compound Name | 8-chloro-7-[4-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]butoxy]-2-methyl-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 86275675 |
| Molecular Formula | C26H28ClFN2O4 |
| Molecular Weight | 486.97 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | 8-chloro-7-[4-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]butoxy]-2-methyl-2,3-dihydrochromen-4-one |
| SMILES | CC1CC(=O)c2ccc(OCCCCN3CCC(c4noc5cc(F)ccc45)CC3)c(Cl)c2O1 |
| InChI | InChI=1S/C26H28ClFN2O4/c1-16-14-21(31)19-6-7-22(24(27)26(19)33-16)32-13-3-2-10-30-11-8-17(9-12-30)25-20-5-4-18(28)15-23(20)34-29-25/h4-7,15-17H,2-3,8-14H2,1H3 |
| InChIKey | MGIPLSRNTCABAG-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 64.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.97 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|