C27H29FN2O4 — CID 71681211
7-[4-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]butoxy]-4,5-dimethylchromen-2-one (PubChem CID 71681211) has the molecular formula C27H29FN2O4 and a molecular weight of 464.54 g/mol. Its IUPAC name is 7-[4-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]butoxy]-4,5-dimethylchromen-2-one.
| Compound Name | 7-[4-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]butoxy]-4,5-dimethylchromen-2-one |
|---|---|
| PubChem CID | 71681211 |
| Molecular Formula | C27H29FN2O4 |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | 7-[4-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]butoxy]-4,5-dimethylchromen-2-one |
| SMILES | Cc1cc(OCCCCN2CCC(c3noc4cc(F)ccc34)CC2)cc2oc(=O)cc(C)c12 |
| InChI | InChI=1S/C27H29FN2O4/c1-17-13-21(16-24-26(17)18(2)14-25(31)33-24)32-12-4-3-9-30-10-7-19(8-11-30)27-22-6-5-20(28)15-23(22)34-29-27/h5-6,13-16,19H,3-4,7-12H2,1-2H3 |
| InChIKey | GGSRAEIJVWEHDH-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 68.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|