C32H33FN2O6 — CID 126961574
(2S)-7-[4-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]butoxy]-5-hydroxy-2-(4-methoxyphenyl)-2,3-dihydrochromen-4-one (PubChem CID 126961574) has the molecular formula C32H33FN2O6 and a molecular weight of 560.62 g/mol. Its IUPAC name is (2S)-7-[4-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]butoxy]-5-hydroxy-2-(4-methoxyphenyl)-2,3-dihydrochromen-4-one.
| Compound Name | (2S)-7-[4-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]butoxy]-5-hydroxy-2-(4-methoxyphenyl)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 126961574 |
| Molecular Formula | C32H33FN2O6 |
| Molecular Weight | 560.62 g/mol |
| Exact Mass | 560.23 |
| IUPAC Name | (2S)-7-[4-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]butoxy]-5-hydroxy-2-(4-methoxyphenyl)-2,3-dihydrochromen-4-one |
| SMILES | COc1ccc([C@@H]2CC(=O)c3c(O)cc(OCCCCN4CCC(c5noc6cc(F)ccc56)CC4)cc3O2)cc1 |
| InChI | InChI=1S/C32H33FN2O6/c1-38-23-7-4-20(5-8-23)28-19-27(37)31-26(36)17-24(18-30(31)40-28)39-15-3-2-12-35-13-10-21(11-14-35)32-25-9-6-22(33)16-29(25)41-34-32/h4-9,16-18,21,28,36H,2-3,10-15,19H2,1H3/t28-/m0/s1 |
| InChIKey | MPKCUAWIBWMDIB-NDEPHWFRSA-N |
| XLogP | 6.43 |
| TPSA | 94.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.62 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|