C23H26O4 — CID 86276430
methyl (1R,2S,3R,4S)-2-ethenyl-1-hydroxy-4-phenyl-3-(phenylmethoxymethyl)cyclopentane-1-carboxylate (PubChem CID 86276430) has the molecular formula C23H26O4 and a molecular weight of 366.46 g/mol. Its IUPAC name is methyl (1R,2S,3R,4S)-2-ethenyl-1-hydroxy-4-phenyl-3-(phenylmethoxymethyl)cyclopentane-1-carboxylate.
| Compound Name | methyl (1R,2S,3R,4S)-2-ethenyl-1-hydroxy-4-phenyl-3-(phenylmethoxymethyl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 86276430 |
| Molecular Formula | C23H26O4 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | methyl (1R,2S,3R,4S)-2-ethenyl-1-hydroxy-4-phenyl-3-(phenylmethoxymethyl)cyclopentane-1-carboxylate |
| SMILES | C=C[C@H]1[C@H](COCc2ccccc2)[C@@H](c2ccccc2)C[C@]1(O)C(=O)OC |
| InChI | InChI=1S/C23H26O4/c1-3-21-20(16-27-15-17-10-6-4-7-11-17)19(18-12-8-5-9-13-18)14-23(21,25)22(24)26-2/h3-13,19-21,25H,1,14-16H2,2H3/t19-,20-,21+,23-/m1/s1 |
| InChIKey | ZDCRSSUDMNLCHR-CUDBPUKSSA-N |
| XLogP | 3.71 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|