C21H28O3 — CID 86276431
methyl (1R,2S,3R,4S)-3-cyclohexyl-2-ethenyl-1-hydroxy-4-phenylcyclopentane-1-carboxylate (PubChem CID 86276431) has the molecular formula C21H28O3 and a molecular weight of 328.45 g/mol. Its IUPAC name is methyl (1R,2S,3R,4S)-3-cyclohexyl-2-ethenyl-1-hydroxy-4-phenylcyclopentane-1-carboxylate.
| Compound Name | methyl (1R,2S,3R,4S)-3-cyclohexyl-2-ethenyl-1-hydroxy-4-phenylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 86276431 |
| Molecular Formula | C21H28O3 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | methyl (1R,2S,3R,4S)-3-cyclohexyl-2-ethenyl-1-hydroxy-4-phenylcyclopentane-1-carboxylate |
| SMILES | C=C[C@H]1[C@H](C2CCCCC2)[C@@H](c2ccccc2)C[C@]1(O)C(=O)OC |
| InChI | InChI=1S/C21H28O3/c1-3-18-19(16-12-8-5-9-13-16)17(15-10-6-4-7-11-15)14-21(18,23)20(22)24-2/h3-4,6-7,10-11,16-19,23H,1,5,8-9,12-14H2,2H3/t17-,18+,19-,21-/m1/s1 |
| InChIKey | KQMFZAVHBSHMOL-RCLSDMTESA-N |
| XLogP | 4.08 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|