C25H27NO4 — CID 86278009
tert-butyl (2S)-5-oxo-2-[(1S)-3-oxo-1-phenylbutyl]-2-phenylpyrrole-1-carboxylate (PubChem CID 86278009) has the molecular formula C25H27NO4 and a molecular weight of 405.49 g/mol. Its IUPAC name is tert-butyl (2S)-5-oxo-2-[(1S)-3-oxo-1-phenylbutyl]-2-phenylpyrrole-1-carboxylate.
| Compound Name | tert-butyl (2S)-5-oxo-2-[(1S)-3-oxo-1-phenylbutyl]-2-phenylpyrrole-1-carboxylate |
|---|---|
| PubChem CID | 86278009 |
| Molecular Formula | C25H27NO4 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | tert-butyl (2S)-5-oxo-2-[(1S)-3-oxo-1-phenylbutyl]-2-phenylpyrrole-1-carboxylate |
| SMILES | CC(=O)C[C@@H](c1ccccc1)[C@]1(c2ccccc2)C=CC(=O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H27NO4/c1-18(27)17-21(19-11-7-5-8-12-19)25(20-13-9-6-10-14-20)16-15-22(28)26(25)23(29)30-24(2,3)4/h5-16,21H,17H2,1-4H3/t21-,25+/m0/s1 |
| InChIKey | AYOSGTVVDHOHMP-SQJMNOBHSA-N |
| XLogP | 4.98 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |