C20H25NO4 — CID 86278010
tert-butyl (2S)-2-methyl-5-oxo-2-[(1R)-3-oxo-1-phenylbutyl]pyrrole-1-carboxylate (PubChem CID 86278010) has the molecular formula C20H25NO4 and a molecular weight of 343.42 g/mol. Its IUPAC name is tert-butyl (2S)-2-methyl-5-oxo-2-[(1R)-3-oxo-1-phenylbutyl]pyrrole-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-methyl-5-oxo-2-[(1R)-3-oxo-1-phenylbutyl]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 86278010 |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | tert-butyl (2S)-2-methyl-5-oxo-2-[(1R)-3-oxo-1-phenylbutyl]pyrrole-1-carboxylate |
| SMILES | CC(=O)C[C@H](c1ccccc1)[C@]1(C)C=CC(=O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H25NO4/c1-14(22)13-16(15-9-7-6-8-10-15)20(5)12-11-17(23)21(20)18(24)25-19(2,3)4/h6-12,16H,13H2,1-5H3/t16-,20+/m1/s1 |
| InChIKey | CVODQVFFSKORST-UZLBHIALSA-N |
| XLogP | 3.84 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |