C18H17N3O4S — CID 86278736
N-(2-cyano-5,6-dimethoxy-1H-indol-3-yl)-4-methylbenzenesulfonamide (PubChem CID 86278736) has the molecular formula C18H17N3O4S and a molecular weight of 371.42 g/mol. Its IUPAC name is N-(2-cyano-5,6-dimethoxy-1H-indol-3-yl)-4-methylbenzenesulfonamide.
| Compound Name | N-(2-cyano-5,6-dimethoxy-1H-indol-3-yl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 86278736 |
| Molecular Formula | C18H17N3O4S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | N-(2-cyano-5,6-dimethoxy-1H-indol-3-yl)-4-methylbenzenesulfonamide |
| SMILES | COc1cc2[nH]c(C#N)c(NS(=O)(=O)c3ccc(C)cc3)c2cc1OC |
| InChI | InChI=1S/C18H17N3O4S/c1-11-4-6-12(7-5-11)26(22,23)21-18-13-8-16(24-2)17(25-3)9-14(13)20-15(18)10-19/h4-9,20-21H,1-3H3 |
| InChIKey | ARVKQHLONNCZAW-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |