C19H18FN3O2S — CID 86284172
N-[[1-(3-fluorophenyl)pyrazol-4-yl]methyl]-4-(2-hydroxyethylsulfanyl)benzamide (PubChem CID 86284172) has the molecular formula C19H18FN3O2S and a molecular weight of 371.44 g/mol. Its IUPAC name is N-[[1-(3-fluorophenyl)pyrazol-4-yl]methyl]-4-(2-hydroxyethylsulfanyl)benzamide.
| Compound Name | N-[[1-(3-fluorophenyl)pyrazol-4-yl]methyl]-4-(2-hydroxyethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 86284172 |
| Molecular Formula | C19H18FN3O2S |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | N-[[1-(3-fluorophenyl)pyrazol-4-yl]methyl]-4-(2-hydroxyethylsulfanyl)benzamide |
| SMILES | O=C(NCc1cnn(-c2cccc(F)c2)c1)c1ccc(SCCO)cc1 |
| InChI | InChI=1S/C19H18FN3O2S/c20-16-2-1-3-17(10-16)23-13-14(12-22-23)11-21-19(25)15-4-6-18(7-5-15)26-9-8-24/h1-7,10,12-13,24H,8-9,11H2,(H,21,25) |
| InChIKey | QBCODJMZQYSULK-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |