C13H15N7O2 — CID 86286168
5-methyl-2-[[3-(oxolan-3-yl)-1H-1,2,4-triazol-5-yl]methyl]-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one (PubChem CID 86286168) has the molecular formula C13H15N7O2 and a molecular weight of 301.31 g/mol. Its IUPAC name is 5-methyl-2-[[3-(oxolan-3-yl)-1H-1,2,4-triazol-5-yl]methyl]-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 5-methyl-2-[[3-(oxolan-3-yl)-1H-1,2,4-triazol-5-yl]methyl]-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 86286168 |
| Molecular Formula | C13H15N7O2 |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 5-methyl-2-[[3-(oxolan-3-yl)-1H-1,2,4-triazol-5-yl]methyl]-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
| SMILES | Cc1cc(=O)n2[nH]c(Cc3nc(C4CCOC4)n[nH]3)nc2n1 |
| InChI | InChI=1S/C13H15N7O2/c1-7-4-11(21)20-13(14-7)16-10(19-20)5-9-15-12(18-17-9)8-2-3-22-6-8/h4,8H,2-3,5-6H2,1H3,(H,14,16,19)(H,15,17,18) |
| InChIKey | WHWIAVAEGBJPDS-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 113.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |