C27H32O6 — CID 86287550
tripropan-2-yl (2S,3S)-2-phenyl-2,3-dihydroindene-1,1,3-tricarboxylate (PubChem CID 86287550) has the molecular formula C27H32O6 and a molecular weight of 452.55 g/mol. Its IUPAC name is tripropan-2-yl (2S,3S)-2-phenyl-2,3-dihydroindene-1,1,3-tricarboxylate.
| Compound Name | tripropan-2-yl (2S,3S)-2-phenyl-2,3-dihydroindene-1,1,3-tricarboxylate |
|---|---|
| PubChem CID | 86287550 |
| Molecular Formula | C27H32O6 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | tripropan-2-yl (2S,3S)-2-phenyl-2,3-dihydroindene-1,1,3-tricarboxylate |
| SMILES | CC(C)OC(=O)[C@@H]1c2ccccc2C(C(=O)OC(C)C)(C(=O)OC(C)C)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C27H32O6/c1-16(2)31-24(28)22-20-14-10-11-15-21(20)27(25(29)32-17(3)4,26(30)33-18(5)6)23(22)19-12-8-7-9-13-19/h7-18,22-23H,1-6H3/t22-,23-/m1/s1 |
| InChIKey | ULPXAJQQEXKSKR-DHIUTWEWSA-N |
| XLogP | 4.66 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|