About (2R)-1-[[5-chloro-2-(3,5-difluorophenyl)phenyl]carbamoyl]azetidine-2-carboxylic acid
(2R)-1-[[5-chloro-2-(3,5-difluorophenyl)phenyl]carbamoyl]azetidine-2-carboxylic acid (PubChem CID 86288007) has the molecular formula C17H13ClF2N2O3
and a molecular weight of 366.75 g/mol. Its IUPAC name is (2R)-1-[[5-chloro-2-(3,5-difluorophenyl)phenyl]carbamoyl]azetidine-2-carboxylic acid.
Molecular Properties
| Compound Name | (2R)-1-[[5-chloro-2-(3,5-difluorophenyl)phenyl]carbamoyl]azetidine-2-carboxylic acid |
| PubChem CID | 86288007 |
| Molecular Formula | C17H13ClF2N2O3 |
| Molecular Weight | 366.75 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | (2R)-1-[[5-chloro-2-(3,5-difluorophenyl)phenyl]carbamoyl]azetidine-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1CCN1C(=O)Nc1cc(Cl)ccc1-c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C17H13ClF2N2O3/c18-10-1-2-13(9-5-11(19)8-12(20)6-9)14(7-10)21-17(25)22-4-3-15(22)16(23)24/h1-2,5-8,15H,3-4H2,(H,21,25)(H,23,24)/t15-/m1/s1 |
| InChIKey | PELJMTVWQYSILO-OAHLLOKOSA-N |
| XLogP | 3.98 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.75 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-1-[[5-chloro-2-(3,5-difluorophenyl)phenyl]carbamoyl]azetidine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-[[5-chloro-2-(3,5-difluorophenyl)phenyl]carbamoyl]azetidine-2-carboxylic acid?
The IUPAC name of (2R)-1-[[5-chloro-2-(3,5-difluorophenyl)phenyl]carbamoyl]azetidine-2-carboxylic acid (CID 86288007) is (2R)-1-[[5-chloro-2-(3,5-difluorophenyl)phenyl]carbamoyl]azetidine-2-carboxylic acid.
What is the SMILES notation for (2R)-1-[[5-chloro-2-(3,5-difluorophenyl)phenyl]carbamoyl]azetidine-2-carboxylic acid?
The canonical SMILES for (2R)-1-[[5-chloro-2-(3,5-difluorophenyl)phenyl]carbamoyl]azetidine-2-carboxylic acid is O=C(O)[C@H]1CCN1C(=O)Nc1cc(Cl)ccc1-c1cc(F)cc(F)c1.
What is the InChIKey of (2R)-1-[[5-chloro-2-(3,5-difluorophenyl)phenyl]carbamoyl]azetidine-2-carboxylic acid?
The InChIKey is PELJMTVWQYSILO-OAHLLOKOSA-N. The full InChI is InChI=1S/C17H13ClF2N2O3/c18-10-1-2-13(9-5-11(19)8-12(20)6-9)14(7-10)21-17(25)22-4-3-15(22)16(23)24/h1-2,5-8,15H,3-4H2,(H,21,25)(H,23,24)/t15-/m1/s1.
What are the key properties of (2R)-1-[[5-chloro-2-(3,5-difluorophenyl)phenyl]carbamoyl]azetidine-2-carboxylic acid?
(2R)-1-[[5-chloro-2-(3,5-difluorophenyl)phenyl]carbamoyl]azetidine-2-carboxylic acid has a molecular weight of 366.75 g/mol, XLogP of 3.98, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-[[5-chloro-2-(3,5-difluorophenyl)phenyl]carbamoyl]azetidine-2-carboxylic acid is sourced from PubChem (CID 86288007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).