C17H16ClN3O3 — CID 86288013
(2R)-1-[(5-chloro-2-pyridin-4-ylphenyl)carbamoyl]pyrrolidine-2-carboxylic acid (PubChem CID 86288013) has the molecular formula C17H16ClN3O3 and a molecular weight of 345.79 g/mol. Its IUPAC name is (2R)-1-[(5-chloro-2-pyridin-4-ylphenyl)carbamoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-1-[(5-chloro-2-pyridin-4-ylphenyl)carbamoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 86288013 |
| Molecular Formula | C17H16ClN3O3 |
| Molecular Weight | 345.79 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | (2R)-1-[(5-chloro-2-pyridin-4-ylphenyl)carbamoyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1CCCN1C(=O)Nc1cc(Cl)ccc1-c1ccncc1 |
| InChI | InChI=1S/C17H16ClN3O3/c18-12-3-4-13(11-5-7-19-8-6-11)14(10-12)20-17(24)21-9-1-2-15(21)16(22)23/h3-8,10,15H,1-2,9H2,(H,20,24)(H,22,23)/t15-/m1/s1 |
| InChIKey | OMADRODHRUZLTJ-OAHLLOKOSA-N |
| XLogP | 3.48 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.79 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |