C19H17F3N2O4 — CID 90460297
1-[[2-phenyl-5-(trifluoromethoxy)phenyl]carbamoyl]pyrrolidine-2-carboxylic acid (PubChem CID 90460297) has the molecular formula C19H17F3N2O4 and a molecular weight of 394.35 g/mol. Its IUPAC name is 1-[[2-phenyl-5-(trifluoromethoxy)phenyl]carbamoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[[2-phenyl-5-(trifluoromethoxy)phenyl]carbamoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 90460297 |
| Molecular Formula | C19H17F3N2O4 |
| Molecular Weight | 394.35 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 1-[[2-phenyl-5-(trifluoromethoxy)phenyl]carbamoyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCN1C(=O)Nc1cc(OC(F)(F)F)ccc1-c1ccccc1 |
| InChI | InChI=1S/C19H17F3N2O4/c20-19(21,22)28-13-8-9-14(12-5-2-1-3-6-12)15(11-13)23-18(27)24-10-4-7-16(24)17(25)26/h1-3,5-6,8-9,11,16H,4,7,10H2,(H,23,27)(H,25,26) |
| InChIKey | HSUGRSJQTMSIRU-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.35 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |