C24H27ClN2O3 — CID 141417313
(2R)-1-[(5-chloro-3-cyclohexyl-2-phenylphenyl)carbamoyl]pyrrolidine-2-carboxylic acid (PubChem CID 141417313) has the molecular formula C24H27ClN2O3 and a molecular weight of 426.94 g/mol. Its IUPAC name is (2R)-1-[(5-chloro-3-cyclohexyl-2-phenylphenyl)carbamoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-1-[(5-chloro-3-cyclohexyl-2-phenylphenyl)carbamoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 141417313 |
| Molecular Formula | C24H27ClN2O3 |
| Molecular Weight | 426.94 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | (2R)-1-[(5-chloro-3-cyclohexyl-2-phenylphenyl)carbamoyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1CCCN1C(=O)Nc1cc(Cl)cc(C2CCCCC2)c1-c1ccccc1 |
| InChI | InChI=1S/C24H27ClN2O3/c25-18-14-19(16-8-3-1-4-9-16)22(17-10-5-2-6-11-17)20(15-18)26-24(30)27-13-7-12-21(27)23(28)29/h2,5-6,10-11,14-16,21H,1,3-4,7-9,12-13H2,(H,26,30)(H,28,29)/t21-/m1/s1 |
| InChIKey | NRBSVJUXUCRYRW-OAQYLSRUSA-N |
| XLogP | 6.14 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.94 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |