C14H11N3 — CID 86288189
2,4-dimethylpyrido[2,3-b]indolizine-10-carbonitrile (PubChem CID 86288189) has the molecular formula C14H11N3 and a molecular weight of 221.26 g/mol. Its IUPAC name is 2,4-dimethylpyrido[2,3-b]indolizine-10-carbonitrile.
| Compound Name | 2,4-dimethylpyrido[2,3-b]indolizine-10-carbonitrile |
|---|---|
| PubChem CID | 86288189 |
| Molecular Formula | C14H11N3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 2,4-dimethylpyrido[2,3-b]indolizine-10-carbonitrile |
| SMILES | Cc1cc(C)c2c(n1)c(C#N)c1ccccn12 |
| InChI | InChI=1S/C14H11N3/c1-9-7-10(2)16-13-11(8-15)12-5-3-4-6-17(12)14(9)13/h3-7H,1-2H3 |
| InChIKey | VJXDKDRYAQYCHT-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 41.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |