C21H31NO2S — CID 86296164
5-[(6Z,9Z,12Z,15E)-octadeca-6,9,12,15-tetraenyl]-1,3-thiazolidine-2,4-dione (PubChem CID 86296164) has the molecular formula C21H31NO2S and a molecular weight of 361.55 g/mol. Its IUPAC name is 5-[(6Z,9Z,12Z,15E)-octadeca-6,9,12,15-tetraenyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[(6Z,9Z,12Z,15E)-octadeca-6,9,12,15-tetraenyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 86296164 |
| Molecular Formula | C21H31NO2S |
| Molecular Weight | 361.55 g/mol |
| Exact Mass | 361.21 |
| IUPAC Name | 5-[(6Z,9Z,12Z,15E)-octadeca-6,9,12,15-tetraenyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CC/C=C/C/C=C\C/C=C\C/C=C\CCCCCC1SC(=O)NC1=O |
| InChI | InChI=1S/C21H31NO2S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(23)22-21(24)25-19/h3-4,6-7,9-10,12-13,19H,2,5,8,11,14-18H2,1H3,(H,22,23,24)/b4-3+,7-6-,10-9-,13-12- |
| InChIKey | FVZBONKEUACNHU-SVQCLFHDSA-N |
| XLogP | 6.09 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.55 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|