C16H16N4OS — CID 86296204
(4aR,7aR)-7a-(3-pyrimidin-5-ylphenyl)-4,4a,6,7-tetrahydrofuro[3,2-d][1,3]thiazin-2-amine (PubChem CID 86296204) has the molecular formula C16H16N4OS and a molecular weight of 312.40 g/mol. Its IUPAC name is (4aR,7aR)-7a-(3-pyrimidin-5-ylphenyl)-4,4a,6,7-tetrahydrofuro[3,2-d][1,3]thiazin-2-amine.
| Compound Name | (4aR,7aR)-7a-(3-pyrimidin-5-ylphenyl)-4,4a,6,7-tetrahydrofuro[3,2-d][1,3]thiazin-2-amine |
|---|---|
| PubChem CID | 86296204 |
| Molecular Formula | C16H16N4OS |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | (4aR,7aR)-7a-(3-pyrimidin-5-ylphenyl)-4,4a,6,7-tetrahydrofuro[3,2-d][1,3]thiazin-2-amine |
| SMILES | NC1=N[C@@]2(c3cccc(-c4cncnc4)c3)CCO[C@H]2CS1 |
| InChI | InChI=1S/C16H16N4OS/c17-15-20-16(4-5-21-14(16)9-22-15)13-3-1-2-11(6-13)12-7-18-10-19-8-12/h1-3,6-8,10,14H,4-5,9H2,(H2,17,20)/t14-,16+/m0/s1 |
| InChIKey | XVUIWXUJXONGGG-GOEBONIOSA-N |
| XLogP | 2.19 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |