C24H31NO4S — CID 86297754
methyl 5-[(Z)-3-[(2R)-2-[(E,3S,4S)-3-hydroxy-4-methyldec-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]prop-1-enyl]thiophene-2-carboxylate (PubChem CID 86297754) has the molecular formula C24H31NO4S and a molecular weight of 429.58 g/mol. Its IUPAC name is methyl 5-[(Z)-3-[(2R)-2-[(E,3S,4S)-3-hydroxy-4-methyldec-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]prop-1-enyl]thiophene-2-carboxylate.
| Compound Name | methyl 5-[(Z)-3-[(2R)-2-[(E,3S,4S)-3-hydroxy-4-methyldec-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]prop-1-enyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 86297754 |
| Molecular Formula | C24H31NO4S |
| Molecular Weight | 429.58 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | methyl 5-[(Z)-3-[(2R)-2-[(E,3S,4S)-3-hydroxy-4-methyldec-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]prop-1-enyl]thiophene-2-carboxylate |
| SMILES | CCCC#CC[C@H](C)[C@H](O)/C=C/[C@H]1CCC(=O)N1C/C=C\c1ccc(C(=O)OC)s1 |
| InChI | InChI=1S/C24H31NO4S/c1-4-5-6-7-9-18(2)21(26)14-11-19-12-16-23(27)25(19)17-8-10-20-13-15-22(30-20)24(28)29-3/h8,10-11,13-15,18-19,21,26H,4-5,9,12,16-17H2,1-3H3/b10-8-,14-11+/t18-,19-,21+/m0/s1 |
| InChIKey | ZCWFJOHTEPXVLA-HJTASCSMSA-N |
| XLogP | 4.29 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.58 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|