C19H17F2N5O2 — CID 86298450
3-[2-fluoro-5-(3-(18F)fluoropropoxy)phenyl]-12-methoxy-5-methyl-2,4,7,8,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene (PubChem CID 86298450) has the molecular formula C19H17F2N5O2 and a molecular weight of 384.38 g/mol. Its IUPAC name is 3-[2-fluoro-5-(3-(18F)fluoropropoxy)phenyl]-12-methoxy-5-methyl-2,4,7,8,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene.
| Compound Name | 3-[2-fluoro-5-(3-(18F)fluoropropoxy)phenyl]-12-methoxy-5-methyl-2,4,7,8,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene |
|---|---|
| PubChem CID | 86298450 |
| Molecular Formula | C19H17F2N5O2 |
| Molecular Weight | 384.38 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 3-[2-fluoro-5-(3-(18F)fluoropropoxy)phenyl]-12-methoxy-5-methyl-2,4,7,8,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene |
| SMILES | COc1ccc2nnc3c(C)nc(-c4cc(OCCC[18F])ccc4F)n3c2n1 |
| InChI | InChI=1S/C19H17F2N5O2/c1-11-17-25-24-15-6-7-16(27-2)23-19(15)26(17)18(22-11)13-10-12(4-5-14(13)21)28-9-3-8-20/h4-7,10H,3,8-9H2,1-2H3/i20-1 |
| InChIKey | AAJCENMHNPMXLK-LRFGSCOBSA-N |
| XLogP | 3.53 |
| TPSA | 74.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|