C21H21ClN4O3 — CID 110173744
3-(5-butoxy-2-chlorophenyl)-12-methoxy-5-methyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-7-one (PubChem CID 110173744) has the molecular formula C21H21ClN4O3 and a molecular weight of 412.88 g/mol. Its IUPAC name is 3-(5-butoxy-2-chlorophenyl)-12-methoxy-5-methyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-7-one.
| Compound Name | 3-(5-butoxy-2-chlorophenyl)-12-methoxy-5-methyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-7-one |
|---|---|
| PubChem CID | 110173744 |
| Molecular Formula | C21H21ClN4O3 |
| Molecular Weight | 412.88 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | 3-(5-butoxy-2-chlorophenyl)-12-methoxy-5-methyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-7-one |
| SMILES | CCCCOc1ccc(Cl)c(-c2nc(C)c3c(=O)[nH]c4ccc(OC)nc4n23)c1 |
| InChI | InChI=1S/C21H21ClN4O3/c1-4-5-10-29-13-6-7-15(22)14(11-13)19-23-12(2)18-21(27)24-16-8-9-17(28-3)25-20(16)26(18)19/h6-9,11H,4-5,10H2,1-3H3,(H,24,27) |
| InChIKey | AZAXGNBTAXEXAV-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.88 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|