C20H17Cl2FN4O — CID 142717793
7-chloro-1-[2-chloro-5-(4-fluorobutoxy)phenyl]-4-methyl-[1,2,4]triazolo[4,3-a]quinoxaline (PubChem CID 142717793) has the molecular formula C20H17Cl2FN4O and a molecular weight of 419.29 g/mol. Its IUPAC name is 7-chloro-1-[2-chloro-5-(4-fluorobutoxy)phenyl]-4-methyl-[1,2,4]triazolo[4,3-a]quinoxaline.
| Compound Name | 7-chloro-1-[2-chloro-5-(4-fluorobutoxy)phenyl]-4-methyl-[1,2,4]triazolo[4,3-a]quinoxaline |
|---|---|
| PubChem CID | 142717793 |
| Molecular Formula | C20H17Cl2FN4O |
| Molecular Weight | 419.29 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | 7-chloro-1-[2-chloro-5-(4-fluorobutoxy)phenyl]-4-methyl-[1,2,4]triazolo[4,3-a]quinoxaline |
| SMILES | Cc1nc2cc(Cl)ccc2n2c(-c3cc(OCCCCF)ccc3Cl)nnc12 |
| InChI | InChI=1S/C20H17Cl2FN4O/c1-12-19-25-26-20(27(19)18-7-4-13(21)10-17(18)24-12)15-11-14(5-6-16(15)22)28-9-3-2-8-23/h4-7,10-11H,2-3,8-9H2,1H3 |
| InChIKey | IXMJQURVUKEORV-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 52.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.29 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|