C25H28ClN5O — CID 90174758
N-[[1-(5-butoxy-2-chlorophenyl)-4-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-8-yl]methyl]cyclobutanamine (PubChem CID 90174758) has the molecular formula C25H28ClN5O and a molecular weight of 449.99 g/mol. Its IUPAC name is N-[[1-(5-butoxy-2-chlorophenyl)-4-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-8-yl]methyl]cyclobutanamine.
| Compound Name | N-[[1-(5-butoxy-2-chlorophenyl)-4-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-8-yl]methyl]cyclobutanamine |
|---|---|
| PubChem CID | 90174758 |
| Molecular Formula | C25H28ClN5O |
| Molecular Weight | 449.99 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | N-[[1-(5-butoxy-2-chlorophenyl)-4-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-8-yl]methyl]cyclobutanamine |
| SMILES | CCCCOc1ccc(Cl)c(-c2nnc3c(C)nc4ccc(CNC5CCC5)cc4n23)c1 |
| InChI | InChI=1S/C25H28ClN5O/c1-3-4-12-32-19-9-10-21(26)20(14-19)25-30-29-24-16(2)28-22-11-8-17(13-23(22)31(24)25)15-27-18-6-5-7-18/h8-11,13-14,18,27H,3-7,12,15H2,1-2H3 |
| InChIKey | IYVNUVREPJDLRM-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 64.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.99 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|