C22H24ClN5O — CID 90030050
1-[1-(5-butoxy-2-chlorophenyl)-4-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-8-yl]ethanamine (PubChem CID 90030050) has the molecular formula C22H24ClN5O and a molecular weight of 409.92 g/mol. Its IUPAC name is 1-[1-(5-butoxy-2-chlorophenyl)-4-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-8-yl]ethanamine.
| Compound Name | 1-[1-(5-butoxy-2-chlorophenyl)-4-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-8-yl]ethanamine |
|---|---|
| PubChem CID | 90030050 |
| Molecular Formula | C22H24ClN5O |
| Molecular Weight | 409.92 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | 1-[1-(5-butoxy-2-chlorophenyl)-4-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-8-yl]ethanamine |
| SMILES | CCCCOc1ccc(Cl)c(-c2nnc3c(C)nc4ccc(C(C)N)cc4n23)c1 |
| InChI | InChI=1S/C22H24ClN5O/c1-4-5-10-29-16-7-8-18(23)17(12-16)22-27-26-21-14(3)25-19-9-6-15(13(2)24)11-20(19)28(21)22/h6-9,11-13H,4-5,10,24H2,1-3H3 |
| InChIKey | WWMZGRUQTMPPLO-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 78.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.92 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|