C23H26N6O5S — CID 86299070
10-(oxan-4-yl)-18,21-dioxa-3-thia-7,10,11,14,23,27-hexazatetracyclo[20.3.1.12,5.08,12]heptacosa-1(26),2(27),4,8,11,22,24-heptaene-6,13-dione (PubChem CID 86299070) has the molecular formula C23H26N6O5S and a molecular weight of 498.57 g/mol. Its IUPAC name is 10-(oxan-4-yl)-18,21-dioxa-3-thia-7,10,11,14,23,27-hexazatetracyclo[20.3.1.12,5.08,12]heptacosa-1(26),2(27),4,8,11,22,24-heptaene-6,13-dione.
| Compound Name | 10-(oxan-4-yl)-18,21-dioxa-3-thia-7,10,11,14,23,27-hexazatetracyclo[20.3.1.12,5.08,12]heptacosa-1(26),2(27),4,8,11,22,24-heptaene-6,13-dione |
|---|---|
| PubChem CID | 86299070 |
| Molecular Formula | C23H26N6O5S |
| Molecular Weight | 498.57 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | 10-(oxan-4-yl)-18,21-dioxa-3-thia-7,10,11,14,23,27-hexazatetracyclo[20.3.1.12,5.08,12]heptacosa-1(26),2(27),4,8,11,22,24-heptaene-6,13-dione |
| SMILES | O=C1Nc2cn(C3CCOCC3)nc2C(=O)NCCCOCCOc2cc(ccn2)-c2nc1cs2 |
| InChI | InChI=1S/C23H26N6O5S/c30-21-18-14-35-23(27-18)15-2-6-24-19(12-15)34-11-10-32-7-1-5-25-22(31)20-17(26-21)13-29(28-20)16-3-8-33-9-4-16/h2,6,12-14,16H,1,3-5,7-11H2,(H,25,31)(H,26,30) |
| InChIKey | MWZNPGIZEWWNHI-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 129.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.57 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |