C21H18N4O — CID 86299757
N-(2-aminophenyl)-2-benzylindazole-5-carboxamide (PubChem CID 86299757) has the molecular formula C21H18N4O and a molecular weight of 342.40 g/mol. Its IUPAC name is N-(2-aminophenyl)-2-benzylindazole-5-carboxamide.
| Compound Name | N-(2-aminophenyl)-2-benzylindazole-5-carboxamide |
|---|---|
| PubChem CID | 86299757 |
| Molecular Formula | C21H18N4O |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | N-(2-aminophenyl)-2-benzylindazole-5-carboxamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc2nn(Cc3ccccc3)cc2c1 |
| InChI | InChI=1S/C21H18N4O/c22-18-8-4-5-9-20(18)23-21(26)16-10-11-19-17(12-16)14-25(24-19)13-15-6-2-1-3-7-15/h1-12,14H,13,22H2,(H,23,26) |
| InChIKey | KCFOJZNHLNNXGD-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|