C20H29F2N3O — CID 86300062
3-cyclohexyl-1-[(2,5-difluorophenyl)methyl]-1-(piperidin-4-ylmethyl)urea (PubChem CID 86300062) has the molecular formula C20H29F2N3O and a molecular weight of 365.47 g/mol. Its IUPAC name is 3-cyclohexyl-1-[(2,5-difluorophenyl)methyl]-1-(piperidin-4-ylmethyl)urea.
| Compound Name | 3-cyclohexyl-1-[(2,5-difluorophenyl)methyl]-1-(piperidin-4-ylmethyl)urea |
|---|---|
| PubChem CID | 86300062 |
| Molecular Formula | C20H29F2N3O |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.23 |
| IUPAC Name | 3-cyclohexyl-1-[(2,5-difluorophenyl)methyl]-1-(piperidin-4-ylmethyl)urea |
| SMILES | O=C(NC1CCCCC1)N(Cc1cc(F)ccc1F)CC1CCNCC1 |
| InChI | InChI=1S/C20H29F2N3O/c21-17-6-7-19(22)16(12-17)14-25(13-15-8-10-23-11-9-15)20(26)24-18-4-2-1-3-5-18/h6-7,12,15,18,23H,1-5,8-11,13-14H2,(H,24,26) |
| InChIKey | YYUQZDYHWRJVCJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |