C24H15F3N5Na2O8PS — CID 86304663
disodium;[9-(6-methylsulfonyl-3-pyridinyl)-2,4-dioxo-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridin-3-yl]methyl phosphate (PubChem CID 86304663) has the molecular formula C24H15F3N5Na2O8PS and a molecular weight of 667.43 g/mol. Its IUPAC name is disodium;[9-(6-methylsulfonyl-3-pyridinyl)-2,4-dioxo-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridin-3-yl]methyl phosphate.
| Compound Name | disodium;[9-(6-methylsulfonyl-3-pyridinyl)-2,4-dioxo-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridin-3-yl]methyl phosphate |
|---|---|
| PubChem CID | 86304663 |
| Molecular Formula | C24H15F3N5Na2O8PS |
| Molecular Weight | 667.43 g/mol |
| Exact Mass | 667.01 |
| IUPAC Name | disodium;[9-(6-methylsulfonyl-3-pyridinyl)-2,4-dioxo-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridin-3-yl]methyl phosphate |
| SMILES | CS(=O)(=O)c1ccc(-c2ccc3ncc4c(=O)n(COP(=O)([O-])[O-])c(=O)n(-c5cccc(C(F)(F)F)c5)c4c3n2)cn1.[Na+].[Na+] |
| InChI | InChI=1S/C24H17F3N5O8PS.2Na/c1-42(38,39)19-8-5-13(10-29-19)17-6-7-18-20(30-17)21-16(11-28-18)22(33)31(12-40-41(35,36)37)23(34)32(21)15-4-2-3-14(9-15)24(25,26)27;;/h2-11H,12H2,1H3,(H2,35,36,37);;/q;2*+1/p-2 |
| InChIKey | XBFJNBQFNKTXBE-UHFFFAOYSA-L |
| XLogP | -4.61 |
| TPSA | 189.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.43 |
| LogP ≤ 5 | -4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|