C18H20N6O3 — CID 86304983
N,3-dimethoxy-5-[2-[2-(1H-pyrazol-4-ylamino)pyrimidin-5-yl]ethyl]benzamide (PubChem CID 86304983) has the molecular formula C18H20N6O3 and a molecular weight of 368.40 g/mol. Its IUPAC name is N,3-dimethoxy-5-[2-[2-(1H-pyrazol-4-ylamino)pyrimidin-5-yl]ethyl]benzamide.
| Compound Name | N,3-dimethoxy-5-[2-[2-(1H-pyrazol-4-ylamino)pyrimidin-5-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 86304983 |
| Molecular Formula | C18H20N6O3 |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | N,3-dimethoxy-5-[2-[2-(1H-pyrazol-4-ylamino)pyrimidin-5-yl]ethyl]benzamide |
| SMILES | CONC(=O)c1cc(CCc2cnc(Nc3cn[nH]c3)nc2)cc(OC)c1 |
| InChI | InChI=1S/C18H20N6O3/c1-26-16-6-12(5-14(7-16)17(25)24-27-2)3-4-13-8-19-18(20-9-13)23-15-10-21-22-11-15/h5-11H,3-4H2,1-2H3,(H,21,22)(H,24,25)(H,19,20,23) |
| InChIKey | UFUBBKXLRMBALR-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 114.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|