C26H37FN4OS — CID 86305099
3-(4-fluoro-N-methylanilino)-N-methyl-N-[(1R,2R,9S,17S)-6-sulfanylidene-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-4-yl]propanamide (PubChem CID 86305099) has the molecular formula C26H37FN4OS and a molecular weight of 472.67 g/mol. Its IUPAC name is 3-(4-fluoro-N-methylanilino)-N-methyl-N-[(1R,2R,9S,17S)-6-sulfanylidene-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-4-yl]propanamide.
| Compound Name | 3-(4-fluoro-N-methylanilino)-N-methyl-N-[(1R,2R,9S,17S)-6-sulfanylidene-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-4-yl]propanamide |
|---|---|
| PubChem CID | 86305099 |
| Molecular Formula | C26H37FN4OS |
| Molecular Weight | 472.67 g/mol |
| Exact Mass | 472.27 |
| IUPAC Name | 3-(4-fluoro-N-methylanilino)-N-methyl-N-[(1R,2R,9S,17S)-6-sulfanylidene-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-4-yl]propanamide |
| SMILES | CN(CCC(=O)N(C)C1CC(=S)N2C[C@@H]3CCCN4CCC[C@@H]([C@H]34)[C@H]2C1)c1ccc(F)cc1 |
| InChI | InChI=1S/C26H37FN4OS/c1-28(20-9-7-19(27)8-10-20)14-11-24(32)29(2)21-15-23-22-6-4-13-30-12-3-5-18(26(22)30)17-31(23)25(33)16-21/h7-10,18,21-23,26H,3-6,11-17H2,1-2H3/t18-,21?,22+,23+,26-/m0/s1 |
| InChIKey | HGOROTDPICFUIH-OZSVCLQOSA-N |
| XLogP | 3.78 |
| TPSA | 30.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.67 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|