C18H22N2O5 — CID 86328534
1-O-[(S)-acetamido(1H-indol-2-yl)methyl] 3-O-ethyl (2S)-2-ethylpropanedioate (PubChem CID 86328534) has the molecular formula C18H22N2O5 and a molecular weight of 346.38 g/mol. Its IUPAC name is 1-O-[(S)-acetamido(1H-indol-2-yl)methyl] 3-O-ethyl (2S)-2-ethylpropanedioate.
| Compound Name | 1-O-[(S)-acetamido(1H-indol-2-yl)methyl] 3-O-ethyl (2S)-2-ethylpropanedioate |
|---|---|
| PubChem CID | 86328534 |
| Molecular Formula | C18H22N2O5 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 1-O-[(S)-acetamido(1H-indol-2-yl)methyl] 3-O-ethyl (2S)-2-ethylpropanedioate |
| SMILES | CCOC(=O)[C@H](CC)C(=O)OC(NC(C)=O)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C18H22N2O5/c1-4-13(17(22)24-5-2)18(23)25-16(19-11(3)21)15-10-12-8-6-7-9-14(12)20-15/h6-10,13,16,20H,4-5H2,1-3H3,(H,19,21)/t13-,16?/m0/s1 |
| InChIKey | ZBXTVCLATWMAHY-KNVGNIICSA-N |
| XLogP | 2.44 |
| TPSA | 97.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|