C14H21BrN2O4S2 — CID 86329240
tert-butyl (3S)-4-(5-bromothiophen-2-yl)sulfonyl-3-methylpiperazine-1-carboxylate (PubChem CID 86329240) has the molecular formula C14H21BrN2O4S2 and a molecular weight of 425.37 g/mol. Its IUPAC name is tert-butyl (3S)-4-(5-bromothiophen-2-yl)sulfonyl-3-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (3S)-4-(5-bromothiophen-2-yl)sulfonyl-3-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 86329240 |
| Molecular Formula | C14H21BrN2O4S2 |
| Molecular Weight | 425.37 g/mol |
| Exact Mass | 424.01 |
| IUPAC Name | tert-butyl (3S)-4-(5-bromothiophen-2-yl)sulfonyl-3-methylpiperazine-1-carboxylate |
| SMILES | C[C@H]1CN(C(=O)OC(C)(C)C)CCN1S(=O)(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C14H21BrN2O4S2/c1-10-9-16(13(18)21-14(2,3)4)7-8-17(10)23(19,20)12-6-5-11(15)22-12/h5-6,10H,7-9H2,1-4H3/t10-/m0/s1 |
| InChIKey | ZMLHLHITMAXYAL-JTQLQIEISA-N |
| XLogP | 3.14 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.37 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |