C21H31N3O4S — CID 162489821
tert-butyl (3R)-4-(azecin-6-ylsulfonyl)-3-methyl-1,4-diazocane-1-carboxylate (PubChem CID 162489821) has the molecular formula C21H31N3O4S and a molecular weight of 421.56 g/mol. Its IUPAC name is tert-butyl (3R)-4-(azecin-6-ylsulfonyl)-3-methyl-1,4-diazocane-1-carboxylate.
| Compound Name | tert-butyl (3R)-4-(azecin-6-ylsulfonyl)-3-methyl-1,4-diazocane-1-carboxylate |
|---|---|
| PubChem CID | 162489821 |
| Molecular Formula | C21H31N3O4S |
| Molecular Weight | 421.56 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | tert-butyl (3R)-4-(azecin-6-ylsulfonyl)-3-methyl-1,4-diazocane-1-carboxylate |
| SMILES | C[C@@H]1CN(C(=O)OC(C)(C)C)CCCCN1S(=O)(=O)c1ccccncccc1 |
| InChI | InChI=1S/C21H31N3O4S/c1-18-17-23(20(25)28-21(2,3)4)15-9-10-16-24(18)29(26,27)19-11-5-7-13-22-14-8-6-12-19/h5-8,11-14,18H,9-10,15-17H2,1-4H3/b7-5+,8-6+,11-5-,12-6+,13-7+,14-8-,19-11+,19-12+,22-13-,22-14-/t18-/m1/s1 |
| InChIKey | XHNFPRSRKTZJSC-CNNBRZOGSA-N |
| XLogP | 3.62 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.56 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |