C20H27N3O5S — CID 66727337
tert-butyl 3-methyl-4-(2-oxidoisoquinolin-2-ium-6-yl)sulfonyl-1,4-diazepane-1-carboxylate (PubChem CID 66727337) has the molecular formula C20H27N3O5S and a molecular weight of 421.52 g/mol. Its IUPAC name is tert-butyl 3-methyl-4-(2-oxidoisoquinolin-2-ium-6-yl)sulfonyl-1,4-diazepane-1-carboxylate.
| Compound Name | tert-butyl 3-methyl-4-(2-oxidoisoquinolin-2-ium-6-yl)sulfonyl-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 66727337 |
| Molecular Formula | C20H27N3O5S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | tert-butyl 3-methyl-4-(2-oxidoisoquinolin-2-ium-6-yl)sulfonyl-1,4-diazepane-1-carboxylate |
| SMILES | CC1CN(C(=O)OC(C)(C)C)CCCN1S(=O)(=O)c1ccc2c[n+]([O-])ccc2c1 |
| InChI | InChI=1S/C20H27N3O5S/c1-15-13-21(19(24)28-20(2,3)4)9-5-10-23(15)29(26,27)18-7-6-17-14-22(25)11-8-16(17)12-18/h6-8,11-12,14-15H,5,9-10,13H2,1-4H3 |
| InChIKey | VJVVSHVHSDDDIL-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 93.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|